C17H18O4 — CID 124923825
(1S,10S,11S,14S)-9,9-dimethoxy-15-oxapentacyclo[8.4.1.111,14.01,10.03,8]hexadeca-3,5,7-trien-2-one (PubChem CID 124923825) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (1S,10S,11S,14S)-9,9-dimethoxy-15-oxapentacyclo[8.4.1.111,14.01,10.03,8]hexadeca-3,5,7-trien-2-one.
| Compound Name | (1S,10S,11S,14S)-9,9-dimethoxy-15-oxapentacyclo[8.4.1.111,14.01,10.03,8]hexadeca-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 124923825 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (1S,10S,11S,14S)-9,9-dimethoxy-15-oxapentacyclo[8.4.1.111,14.01,10.03,8]hexadeca-3,5,7-trien-2-one |
| SMILES | COC1(OC)c2ccccc2C(=O)[C@@]23O[C@]12[C@H]1CC[C@H]3C1 |
| InChI | InChI=1S/C17H18O4/c1-19-17(20-2)13-6-4-3-5-12(13)14(18)15-10-7-8-11(9-10)16(15,17)21-15/h3-6,10-11H,7-9H2,1-2H3/t10-,11-,15+,16-/m0/s1 |
| InChIKey | NVUKXINSKXVELQ-QMMBQJITSA-N |
| XLogP | 2.27 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|