C14H10Cl6O4 — CID 124923964
(1R,2R,3R,4R,5S,6S,7S,8R)-1,8,9,10,11,11-hexachlorotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid (PubChem CID 124923964) has the molecular formula C14H10Cl6O4 and a molecular weight of 454.95 g/mol. Its IUPAC name is (1R,2R,3R,4R,5S,6S,7S,8R)-1,8,9,10,11,11-hexachlorotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid.
| Compound Name | (1R,2R,3R,4R,5S,6S,7S,8R)-1,8,9,10,11,11-hexachlorotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 124923964 |
| Molecular Formula | C14H10Cl6O4 |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 451.87 |
| IUPAC Name | (1R,2R,3R,4R,5S,6S,7S,8R)-1,8,9,10,11,11-hexachlorotetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@H]2C[C@@H]([C@@H]1C(=O)O)[C@H]1[C@@H]2[C@@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C14H10Cl6O4/c15-8-9(16)13(18)7-3-1-2(4(10(21)22)5(3)11(23)24)6(7)12(8,17)14(13,19)20/h2-7H,1H2,(H,21,22)(H,23,24)/t2-,3+,4-,5+,6-,7+,12-,13-/m1/s1 |
| InChIKey | LSPDXZBVBRMBPH-FAYCHRJWSA-N |
| XLogP | 4.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|