C13H16O5S — CID 124924078
methyl (1S,4R,5R,7R,10R)-5-methylsulfonyloxytricyclo[5.2.1.04,10]deca-2,8-diene-2-carboxylate (PubChem CID 124924078) has the molecular formula C13H16O5S and a molecular weight of 284.33 g/mol. Its IUPAC name is methyl (1S,4R,5R,7R,10R)-5-methylsulfonyloxytricyclo[5.2.1.04,10]deca-2,8-diene-2-carboxylate.
| Compound Name | methyl (1S,4R,5R,7R,10R)-5-methylsulfonyloxytricyclo[5.2.1.04,10]deca-2,8-diene-2-carboxylate |
|---|---|
| PubChem CID | 124924078 |
| Molecular Formula | C13H16O5S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | methyl (1S,4R,5R,7R,10R)-5-methylsulfonyloxytricyclo[5.2.1.04,10]deca-2,8-diene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@H]2[C@H]3[C@@H]1C=C[C@H]3C[C@H]2OS(C)(=O)=O |
| InChI | InChI=1S/C13H16O5S/c1-17-13(14)9-6-10-11(18-19(2,15)16)5-7-3-4-8(9)12(7)10/h3-4,6-8,10-12H,5H2,1-2H3/t7-,8+,10+,11+,12+/m0/s1 |
| InChIKey | NPCOZSPTTNSKPU-RULNCXCMSA-N |
| XLogP | 0.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|