C12H19BrO2 — CID 124925000
(1'R,3'S,4'R,6'S)-3'-bromo-5',5',6'-trimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane] (PubChem CID 124925000) has the molecular formula C12H19BrO2 and a molecular weight of 275.19 g/mol. Its IUPAC name is (1'R,3'S,4'R,6'S)-3'-bromo-5',5',6'-trimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane].
| Compound Name | (1'R,3'S,4'R,6'S)-3'-bromo-5',5',6'-trimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 124925000 |
| Molecular Formula | C12H19BrO2 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (1'R,3'S,4'R,6'S)-3'-bromo-5',5',6'-trimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane] |
| SMILES | C[C@H]1[C@H]2C[C@@H]([C@H](Br)C23OCCO3)C1(C)C |
| InChI | InChI=1S/C12H19BrO2/c1-7-8-6-9(11(7,2)3)10(13)12(8)14-4-5-15-12/h7-10H,4-6H2,1-3H3/t7-,8+,9-,10-/m0/s1 |
| InChIKey | MBWIJPYDHZDSFW-JXUBOQSCSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|