C23H20N2O2 — CID 124925153
(Z)-2-cyano-N-(2,6-dimethylphenyl)-3-(4-methoxynaphthalen-1-yl)prop-2-enamide (PubChem CID 124925153) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,6-dimethylphenyl)-3-(4-methoxynaphthalen-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,6-dimethylphenyl)-3-(4-methoxynaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 124925153 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (Z)-2-cyano-N-(2,6-dimethylphenyl)-3-(4-methoxynaphthalen-1-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C(/C#N)C(=O)Nc2c(C)cccc2C)c2ccccc12 |
| InChI | InChI=1S/C23H20N2O2/c1-15-7-6-8-16(2)22(15)25-23(26)18(14-24)13-17-11-12-21(27-3)20-10-5-4-9-19(17)20/h4-13H,1-3H3,(H,25,26)/b18-13- |
| InChIKey | YANHFUFLVMKUTQ-AQTBWJFISA-N |
| XLogP | 5.01 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|