C18H11ClN2 — CID 124925583
(15S,16S)-15-chlorotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarbonitrile (PubChem CID 124925583) has the molecular formula C18H11ClN2 and a molecular weight of 290.75 g/mol. Its IUPAC name is (15S,16S)-15-chlorotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarbonitrile.
| Compound Name | (15S,16S)-15-chlorotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarbonitrile |
|---|---|
| PubChem CID | 124925583 |
| Molecular Formula | C18H11ClN2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (15S,16S)-15-chlorotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15,16-dicarbonitrile |
| SMILES | N#C[C@@H]1C2c3ccccc3C(c3ccccc32)[C@@]1(Cl)C#N |
| InChI | InChI=1S/C18H11ClN2/c19-18(10-21)15(9-20)16-11-5-1-3-7-13(11)17(18)14-8-4-2-6-12(14)16/h1-8,15-17H/t15-,16?,17?,18-/m1/s1 |
| InChIKey | BKDGOMXFZDSBJP-AQEOSJORSA-N |
| XLogP | 3.92 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|