About (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate
(4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate (PubChem CID 124925838) has the molecular formula C15H21NO5
and a molecular weight of 295.33 g/mol. Its IUPAC name is (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate.
Molecular Properties
| Compound Name | (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate |
| PubChem CID | 124925838 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate |
| SMILES | O=C(OC1CCC(O)CC1)[C@@H](CO)NOc1ccccc1 |
| InChI | InChI=1S/C15H21NO5/c17-10-14(16-21-13-4-2-1-3-5-13)15(19)20-12-8-6-11(18)7-9-12/h1-5,11-12,14,16-18H,6-10H2/t11?,12?,14-/m1/s1 |
| InChIKey | DJYQBHKBHPKEEL-ORHYLEIMSA-N |
| XLogP | 0.78 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate?
The IUPAC name of (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate (CID 124925838) is (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate.
What is the SMILES notation for (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate?
The canonical SMILES for (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate is O=C(OC1CCC(O)CC1)[C@@H](CO)NOc1ccccc1.
What is the InChIKey of (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate?
The InChIKey is DJYQBHKBHPKEEL-ORHYLEIMSA-N. The full InChI is InChI=1S/C15H21NO5/c17-10-14(16-21-13-4-2-1-3-5-13)15(19)20-12-8-6-11(18)7-9-12/h1-5,11-12,14,16-18H,6-10H2/t11?,12?,14-/m1/s1.
What are the key properties of (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate?
(4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate has a molecular weight of 295.33 g/mol, XLogP of 0.78, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxycyclohexyl) (2R)-3-hydroxy-2-(phenoxyamino)propanoate is sourced from PubChem (CID 124925838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).