About [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium
[(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium (PubChem CID 124926466) has the molecular formula C10H13Cl2N2+
and a molecular weight of 232.13 g/mol. Its IUPAC name is [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium.
Molecular Properties
| Compound Name | [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium |
| PubChem CID | 124926466 |
| Molecular Formula | C10H13Cl2N2+ |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium |
| SMILES | C[N+](C)(C)/N=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H13Cl2N2/c1-14(2,3)13-7-8-9(11)5-4-6-10(8)12/h4-7H,1-3H3/q+1/b13-7- |
| InChIKey | IYUOQQDZKKIKQP-QPEQYQDCSA-N |
| XLogP | 3.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium?
The IUPAC name of [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium (CID 124926466) is [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium.
What is the SMILES notation for [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium?
The canonical SMILES for [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium is C[N+](C)(C)/N=C\c1c(Cl)cccc1Cl.
What is the InChIKey of [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium?
The InChIKey is IYUOQQDZKKIKQP-QPEQYQDCSA-N. The full InChI is InChI=1S/C10H13Cl2N2/c1-14(2,3)13-7-8-9(11)5-4-6-10(8)12/h4-7H,1-3H3/q+1/b13-7-.
What are the key properties of [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium?
[(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium has a molecular weight of 232.13 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(2,6-dichlorophenyl)methylideneamino]-trimethylazanium is sourced from PubChem (CID 124926466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).