C10H9FN2O2 — CID 124927269
1-ethyl-4-fluorobenzimidazole-2-carboxylic acid (PubChem CID 124927269) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is 1-ethyl-4-fluorobenzimidazole-2-carboxylic acid.
| Compound Name | 1-ethyl-4-fluorobenzimidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 124927269 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 1-ethyl-4-fluorobenzimidazole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)nc2c(F)cccc21 |
| InChI | InChI=1S/C10H9FN2O2/c1-2-13-7-5-3-4-6(11)8(7)12-9(13)10(14)15/h3-5H,2H2,1H3,(H,14,15) |
| InChIKey | PDVBBXVIFLXQOS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |