About (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide
(R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide (PubChem CID 124927885) has the molecular formula C11H14N4OS2
and a molecular weight of 282.39 g/mol. Its IUPAC name is (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide.
Molecular Properties
| Compound Name | (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide |
| PubChem CID | 124927885 |
| Molecular Formula | C11H14N4OS2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide |
| SMILES | Cc1nc(NCCc2ccncc2)sc1[S@](N)=O |
| InChI | InChI=1S/C11H14N4OS2/c1-8-10(18(12)16)17-11(15-8)14-7-4-9-2-5-13-6-3-9/h2-3,5-6H,4,7,12H2,1H3,(H,14,15)/t18-/m1/s1 |
| InChIKey | UNMHQXNZSSVECK-GOSISDBHSA-N |
| XLogP | 1.48 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide?
The IUPAC name of (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide (CID 124927885) is (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide.
What is the SMILES notation for (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide?
The canonical SMILES for (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide is Cc1nc(NCCc2ccncc2)sc1[S@](N)=O.
What is the InChIKey of (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide?
The InChIKey is UNMHQXNZSSVECK-GOSISDBHSA-N. The full InChI is InChI=1S/C11H14N4OS2/c1-8-10(18(12)16)17-11(15-8)14-7-4-9-2-5-13-6-3-9/h2-3,5-6H,4,7,12H2,1H3,(H,14,15)/t18-/m1/s1.
What are the key properties of (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide?
(R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide has a molecular weight of 282.39 g/mol, XLogP of 1.48, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-4-methyl-2-(2-pyridin-4-ylethylamino)-1,3-thiazole-5-sulfinamide is sourced from PubChem (CID 124927885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).