About N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide
N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide (PubChem CID 124927893) has the molecular formula C18H22N4
and a molecular weight of 294.40 g/mol. Its IUPAC name is N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide.
Molecular Properties
| Compound Name | N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide |
| PubChem CID | 124927893 |
| Molecular Formula | C18H22N4 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide |
| SMILES | CN(/C=N/c1ccccc1)CCN(C)/C=N/c1ccccc1 |
| InChI | InChI=1S/C18H22N4/c1-21(15-19-17-9-5-3-6-10-17)13-14-22(2)16-20-18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3/b19-15+,20-16+ |
| InChIKey | UNZSMPMSHLQFJB-MXWIWYRXSA-N |
| XLogP | 3.57 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide?
The IUPAC name of N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide (CID 124927893) is N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide.
What is the SMILES notation for N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide?
The canonical SMILES for N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide is CN(/C=N/c1ccccc1)CCN(C)/C=N/c1ccccc1.
What is the InChIKey of N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide?
The InChIKey is UNZSMPMSHLQFJB-MXWIWYRXSA-N. The full InChI is InChI=1S/C18H22N4/c1-21(15-19-17-9-5-3-6-10-17)13-14-22(2)16-20-18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3/b19-15+,20-16+.
What are the key properties of N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide?
N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide has a molecular weight of 294.40 g/mol, XLogP of 3.57, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[2-[methyl(phenyliminomethyl)amino]ethyl]-N'-phenylmethanimidamide is sourced from PubChem (CID 124927893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).