C16H29NO3Si2 — CID 124928211
cis-trimethylsilyl (1R,2E,4S)-2-[cyano(trimethylsilyloxy)methylidene]-4-methylcyclohexane-1-carboxylate (PubChem CID 124928211) has the molecular formula C16H29NO3Si2 and a molecular weight of 339.58 g/mol. Its IUPAC name is cis-trimethylsilyl (1R,2E,4S)-2-[cyano(trimethylsilyloxy)methylidene]-4-methylcyclohexane-1-carboxylate.
| Compound Name | cis-trimethylsilyl (1R,2E,4S)-2-[cyano(trimethylsilyloxy)methylidene]-4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 124928211 |
| Molecular Formula | C16H29NO3Si2 |
| Molecular Weight | 339.58 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | cis-trimethylsilyl (1R,2E,4S)-2-[cyano(trimethylsilyloxy)methylidene]-4-methylcyclohexane-1-carboxylate |
| SMILES | C[C@H]1CC[C@@H](C(=O)O[Si](C)(C)C)/C(=C(\C#N)O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C16H29NO3Si2/c1-12-8-9-13(16(18)20-22(5,6)7)14(10-12)15(11-17)19-21(2,3)4/h12-13H,8-10H2,1-7H3/b15-14+/t12-,13+/m0/s1 |
| InChIKey | XCJIILCOJXPBCB-QUFAOJHZSA-N |
| XLogP | 4.43 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|