C9H19NO5S — CID 124928924
(2R,3R,4S,5R,6S)-2-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methylsulfanyloxane-3,4,5-triol (PubChem CID 124928924) has the molecular formula C9H19NO5S and a molecular weight of 253.32 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methylsulfanyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 124928924 |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-[(1R,2S)-1-amino-2-hydroxypropyl]-6-methylsulfanyloxane-3,4,5-triol |
| SMILES | CS[C@@H]1O[C@H]([C@H](N)[C@H](C)O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H19NO5S/c1-3(11)4(10)8-6(13)5(12)7(14)9(15-8)16-2/h3-9,11-14H,10H2,1-2H3/t3-,4+,5-,6+,7+,8+,9-/m0/s1 |
| InChIKey | AEEIMWYSDWZKAT-HDNLLMDGSA-N |
| XLogP | -2.13 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |