C14H25NO5S — CID 124929285
(2R)-2-acetamido-3-[(2S,3R,5S)-5-hydroxy-2-pentyloxolan-3-yl]sulfanylpropanoic acid (PubChem CID 124929285) has the molecular formula C14H25NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(2S,3R,5S)-5-hydroxy-2-pentyloxolan-3-yl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(2S,3R,5S)-5-hydroxy-2-pentyloxolan-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 124929285 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (2R)-2-acetamido-3-[(2S,3R,5S)-5-hydroxy-2-pentyloxolan-3-yl]sulfanylpropanoic acid |
| SMILES | CCCCC[C@@H]1O[C@H](O)C[C@H]1SC[C@H](NC(C)=O)C(=O)O |
| InChI | InChI=1S/C14H25NO5S/c1-3-4-5-6-11-12(7-13(17)20-11)21-8-10(14(18)19)15-9(2)16/h10-13,17H,3-8H2,1-2H3,(H,15,16)(H,18,19)/t10-,11-,12+,13-/m0/s1 |
| InChIKey | DEWNQQSQBYUUAE-RVMXOQNASA-N |
| XLogP | 1.37 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|