C20H12Cl12 — CID 124935103
(1R,2R,3R,4S,7S,8S,10R,11R,12R,13R,16R,17S)-4,5,6,7,13,14,15,16,19,19,20,20-dodecachloroheptacyclo[9.6.1.14,7.113,16.02,10.03,8.012,17]icosa-5,14-diene (PubChem CID 124935103) has the molecular formula C20H12Cl12 and a molecular weight of 677.75 g/mol. Its IUPAC name is (1R,2R,3R,4S,7S,8S,10R,11R,12R,13R,16R,17S)-4,5,6,7,13,14,15,16,19,19,20,20-dodecachloroheptacyclo[9.6.1.14,7.113,16.02,10.03,8.012,17]icosa-5,14-diene.
| Compound Name | (1R,2R,3R,4S,7S,8S,10R,11R,12R,13R,16R,17S)-4,5,6,7,13,14,15,16,19,19,20,20-dodecachloroheptacyclo[9.6.1.14,7.113,16.02,10.03,8.012,17]icosa-5,14-diene |
|---|---|
| PubChem CID | 124935103 |
| Molecular Formula | C20H12Cl12 |
| Molecular Weight | 677.75 g/mol |
| Exact Mass | 671.72 |
| IUPAC Name | (1R,2R,3R,4S,7S,8S,10R,11R,12R,13R,16R,17S)-4,5,6,7,13,14,15,16,19,19,20,20-dodecachloroheptacyclo[9.6.1.14,7.113,16.02,10.03,8.012,17]icosa-5,14-diene |
| SMILES | ClC1=C(Cl)[C@@]2(Cl)[C@H]3C[C@@H]4[C@H]5C[C@H]([C@@H]4[C@H]3[C@@]1(Cl)C2(Cl)Cl)[C@H]1[C@@H]5[C@@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C20H12Cl12/c21-11-12(22)18(28)10-6(15(11,25)19(18,29)30)2-3-4-1-5(7(3)10)9-8(4)16(26)13(23)14(24)17(9,27)20(16,31)32/h3-10H,1-2H2/t3-,4-,5-,6+,7-,8-,9+,10+,15+,16-,17-,18+/m1/s1 |
| InChIKey | COOHPPAZRZIWHM-BEVWCMSJSA-N |
| XLogP | 9.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.75 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|