About (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane
(2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane (PubChem CID 124935603) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane.
Analyze (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane?
The IUPAC name of (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane (CID 124935603) is (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane.
What is the SMILES notation for (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane?
The canonical SMILES for (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane is C[C@@H]1CC[C@H]2[C@H](C1)N1CCN2CC1.
What is the InChIKey of (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane?
The InChIKey is JWAPEQMZRFCXDF-VWYCJHECSA-N. The full InChI is InChI=1S/C11H20N2/c1-9-2-3-10-11(8-9)13-6-4-12(10)5-7-13/h9-11H,2-8H2,1H3/t9-,10+,11+/m1/s1.
What are the key properties of (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane?
(2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane has a molecular weight of 180.29 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R,7S)-4-methyl-1,8-diazatricyclo[6.2.2.02,7]dodecane is sourced from PubChem (CID 124935603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).