About 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid
2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid (PubChem CID 124938337) has the molecular formula C12H12N2O3S
and a molecular weight of 264.31 g/mol. Its IUPAC name is 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid.
Molecular Properties
| Compound Name | 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid |
| PubChem CID | 124938337 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid |
| SMILES | Cc1ccc(C[C@H]2SC(N)=NC2=O)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H12N2O3S/c1-6-2-3-7(8(4-6)11(16)17)5-9-10(15)14-12(13)18-9/h2-4,9H,5H2,1H3,(H,16,17)(H2,13,14,15)/t9-/m1/s1 |
| InChIKey | LZGUCCZOKWQWKS-SECBINFHSA-N |
| XLogP | 1.19 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid?
The IUPAC name of 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid (CID 124938337) is 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid.
What is the SMILES notation for 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid?
The canonical SMILES for 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid is Cc1ccc(C[C@H]2SC(N)=NC2=O)c(C(=O)O)c1.
What is the InChIKey of 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid?
The InChIKey is LZGUCCZOKWQWKS-SECBINFHSA-N. The full InChI is InChI=1S/C12H12N2O3S/c1-6-2-3-7(8(4-6)11(16)17)5-9-10(15)14-12(13)18-9/h2-4,9H,5H2,1H3,(H,16,17)(H2,13,14,15)/t9-/m1/s1.
What are the key properties of 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid?
2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid has a molecular weight of 264.31 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(5R)-2-amino-4-oxo-1,3-thiazol-5-yl]methyl]-5-methylbenzoic acid is sourced from PubChem (CID 124938337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).