C26H31N3O6 — CID 124939199
(1R,9S)-11-[(2R,3S)-1-methyl-5-oxo-2-(2,3,4-trimethoxyphenyl)pyrrolidine-3-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 124939199) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is (1R,9S)-11-[(2R,3S)-1-methyl-5-oxo-2-(2,3,4-trimethoxyphenyl)pyrrolidine-3-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-[(2R,3S)-1-methyl-5-oxo-2-(2,3,4-trimethoxyphenyl)pyrrolidine-3-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 124939199 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (1R,9S)-11-[(2R,3S)-1-methyl-5-oxo-2-(2,3,4-trimethoxyphenyl)pyrrolidine-3-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | COc1ccc([C@H]2[C@@H](C(=O)N3C[C@@H]4C[C@H](C3)c3cccc(=O)n3C4)CC(=O)N2C)c(OC)c1OC |
| InChI | InChI=1S/C26H31N3O6/c1-27-22(31)11-18(23(27)17-8-9-20(33-2)25(35-4)24(17)34-3)26(32)28-12-15-10-16(14-28)19-6-5-7-21(30)29(19)13-15/h5-9,15-16,18,23H,10-14H2,1-4H3/t15-,16+,18-,23-/m0/s1 |
| InChIKey | KFYGSWIZNNAVCV-FIEAQMJYSA-N |
| XLogP | 2.04 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |