C28H31N3O7 — CID 124939423
(3R)-3-(3,4-dimethoxyphenyl)-3-[3-hydroxy-4-oxo-6-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]pyran-2-yl]propanamide (PubChem CID 124939423) has the molecular formula C28H31N3O7 and a molecular weight of 521.57 g/mol. Its IUPAC name is (3R)-3-(3,4-dimethoxyphenyl)-3-[3-hydroxy-4-oxo-6-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]pyran-2-yl]propanamide.
| Compound Name | (3R)-3-(3,4-dimethoxyphenyl)-3-[3-hydroxy-4-oxo-6-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]pyran-2-yl]propanamide |
|---|---|
| PubChem CID | 124939423 |
| Molecular Formula | C28H31N3O7 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (3R)-3-(3,4-dimethoxyphenyl)-3-[3-hydroxy-4-oxo-6-[[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]methyl]pyran-2-yl]propanamide |
| SMILES | COc1ccc([C@@H](CC(N)=O)c2oc(CN3C[C@@H]4C[C@H](C3)c3cccc(=O)n3C4)cc(=O)c2O)cc1OC |
| InChI | InChI=1S/C28H31N3O7/c1-36-23-7-6-17(9-24(23)37-2)20(11-25(29)33)28-27(35)22(32)10-19(38-28)15-30-12-16-8-18(14-30)21-4-3-5-26(34)31(21)13-16/h3-7,9-10,16,18,20,35H,8,11-15H2,1-2H3,(H2,29,33)/t16-,18+,20+/m0/s1 |
| InChIKey | XFMJHCZPTXJDKG-ILZDJORESA-N |
| XLogP | 2.15 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |