C14H20N4O — CID 124940557
[(3R)-3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-cyclobutylmethanone (PubChem CID 124940557) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is [(3R)-3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-cyclobutylmethanone.
| Compound Name | [(3R)-3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 124940557 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [(3R)-3-(2-aminopyrimidin-4-yl)piperidin-1-yl]-cyclobutylmethanone |
| SMILES | Nc1nccc([C@@H]2CCCN(C(=O)C3CCC3)C2)n1 |
| InChI | InChI=1S/C14H20N4O/c15-14-16-7-6-12(17-14)11-5-2-8-18(9-11)13(19)10-3-1-4-10/h6-7,10-11H,1-5,8-9H2,(H2,15,16,17)/t11-/m1/s1 |
| InChIKey | AHBGCTYQKAVXFX-LLVKDONJSA-N |
| XLogP | 1.56 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |