C22H25ClFNO4 — CID 124940840
2-[(2S)-2-[(4-chloro-3-fluorophenyl)methyl]-2-methyl-3H-1-benzofuran-5-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 124940840) has the molecular formula C22H25ClFNO4 and a molecular weight of 421.90 g/mol. Its IUPAC name is 2-[(2S)-2-[(4-chloro-3-fluorophenyl)methyl]-2-methyl-3H-1-benzofuran-5-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-[(2S)-2-[(4-chloro-3-fluorophenyl)methyl]-2-methyl-3H-1-benzofuran-5-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 124940840 |
| Molecular Formula | C22H25ClFNO4 |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 2-[(2S)-2-[(4-chloro-3-fluorophenyl)methyl]-2-methyl-3H-1-benzofuran-5-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | C[C@]1(Cc2ccc(Cl)c(F)c2)Cc2cc(CC(=O)NCCOCCO)ccc2O1 |
| InChI | InChI=1S/C22H25ClFNO4/c1-22(13-16-2-4-18(23)19(24)11-16)14-17-10-15(3-5-20(17)29-22)12-21(27)25-6-8-28-9-7-26/h2-5,10-11,26H,6-9,12-14H2,1H3,(H,25,27)/t22-/m0/s1 |
| InChIKey | AIZYTOCJVNIANK-QFIPXVFZSA-N |
| XLogP | 3.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|