C17H17FN4O2 — CID 124941438
(2R)-1-[2-(2-fluorophenyl)acetyl]-2-pyrazin-2-ylpyrrolidine-2-carboxamide (PubChem CID 124941438) has the molecular formula C17H17FN4O2 and a molecular weight of 328.35 g/mol. Its IUPAC name is (2R)-1-[2-(2-fluorophenyl)acetyl]-2-pyrazin-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[2-(2-fluorophenyl)acetyl]-2-pyrazin-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 124941438 |
| Molecular Formula | C17H17FN4O2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2R)-1-[2-(2-fluorophenyl)acetyl]-2-pyrazin-2-ylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@]1(c2cnccn2)CCCN1C(=O)Cc1ccccc1F |
| InChI | InChI=1S/C17H17FN4O2/c18-13-5-2-1-4-12(13)10-15(23)22-9-3-6-17(22,16(19)24)14-11-20-7-8-21-14/h1-2,4-5,7-8,11H,3,6,9-10H2,(H2,19,24)/t17-/m1/s1 |
| InChIKey | ANKGVRYEEFROCS-QGZVFWFLSA-N |
| XLogP | 1.16 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |