C16H21N3OS — CID 124941970
1-[(2R)-2-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]-2-(5-methylthiophen-2-yl)ethanone (PubChem CID 124941970) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-[(2R)-2-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]-2-(5-methylthiophen-2-yl)ethanone.
| Compound Name | 1-[(2R)-2-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]-2-(5-methylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 124941970 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 1-[(2R)-2-(4-methyl-1H-pyrazol-5-yl)piperidin-1-yl]-2-(5-methylthiophen-2-yl)ethanone |
| SMILES | Cc1ccc(CC(=O)N2CCCC[C@@H]2c2[nH]ncc2C)s1 |
| InChI | InChI=1S/C16H21N3OS/c1-11-10-17-18-16(11)14-5-3-4-8-19(14)15(20)9-13-7-6-12(2)21-13/h6-7,10,14H,3-5,8-9H2,1-2H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | AREMRGUSTLWMHG-CQSZACIVSA-N |
| XLogP | 3.38 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |