C28H33N3O3 — CID 124942525
(2-methoxy-5-piperidin-1-ylphenyl)-[(6R)-6-(quinolin-5-ylmethyl)-1,4-oxazepan-4-yl]methanone (PubChem CID 124942525) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is (2-methoxy-5-piperidin-1-ylphenyl)-[(6R)-6-(quinolin-5-ylmethyl)-1,4-oxazepan-4-yl]methanone.
| Compound Name | (2-methoxy-5-piperidin-1-ylphenyl)-[(6R)-6-(quinolin-5-ylmethyl)-1,4-oxazepan-4-yl]methanone |
|---|---|
| PubChem CID | 124942525 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | (2-methoxy-5-piperidin-1-ylphenyl)-[(6R)-6-(quinolin-5-ylmethyl)-1,4-oxazepan-4-yl]methanone |
| SMILES | COc1ccc(N2CCCCC2)cc1C(=O)N1CCOC[C@H](Cc2cccc3ncccc23)C1 |
| InChI | InChI=1S/C28H33N3O3/c1-33-27-11-10-23(30-13-3-2-4-14-30)18-25(27)28(32)31-15-16-34-20-21(19-31)17-22-7-5-9-26-24(22)8-6-12-29-26/h5-12,18,21H,2-4,13-17,19-20H2,1H3/t21-/m1/s1 |
| InChIKey | AVWSFNLOJSEVCJ-OAQYLSRUSA-N |
| XLogP | 4.57 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|