C18H26N2O3 — CID 124943295
2-[(3S)-3-(N-ethylanilino)-1-oxa-8-azaspiro[4.5]decan-8-yl]acetic acid (PubChem CID 124943295) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[(3S)-3-(N-ethylanilino)-1-oxa-8-azaspiro[4.5]decan-8-yl]acetic acid.
| Compound Name | 2-[(3S)-3-(N-ethylanilino)-1-oxa-8-azaspiro[4.5]decan-8-yl]acetic acid |
|---|---|
| PubChem CID | 124943295 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-[(3S)-3-(N-ethylanilino)-1-oxa-8-azaspiro[4.5]decan-8-yl]acetic acid |
| SMILES | CCN(c1ccccc1)[C@@H]1COC2(CCN(CC(=O)O)CC2)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-2-20(15-6-4-3-5-7-15)16-12-18(23-14-16)8-10-19(11-9-18)13-17(21)22/h3-7,16H,2,8-14H2,1H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | BBNIIKYNXZJFOG-INIZCTEOSA-N |
| XLogP | 2.22 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |