C14H20N6O2S — CID 124943744
5-[[(4S)-1-(1H-pyrazol-4-ylsulfonyl)azepan-4-yl]methyl]pyrazin-2-amine (PubChem CID 124943744) has the molecular formula C14H20N6O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 5-[[(4S)-1-(1H-pyrazol-4-ylsulfonyl)azepan-4-yl]methyl]pyrazin-2-amine.
| Compound Name | 5-[[(4S)-1-(1H-pyrazol-4-ylsulfonyl)azepan-4-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 124943744 |
| Molecular Formula | C14H20N6O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 5-[[(4S)-1-(1H-pyrazol-4-ylsulfonyl)azepan-4-yl]methyl]pyrazin-2-amine |
| SMILES | Nc1cnc(C[C@H]2CCCN(S(=O)(=O)c3cn[nH]c3)CC2)cn1 |
| InChI | InChI=1S/C14H20N6O2S/c15-14-10-16-12(7-17-14)6-11-2-1-4-20(5-3-11)23(21,22)13-8-18-19-9-13/h7-11H,1-6H2,(H2,15,17)(H,18,19)/t11-/m0/s1 |
| InChIKey | BEUTXXGHJBDUFP-NSHDSACASA-N |
| XLogP | 0.82 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |