C19H30N6 — CID 124944029
N-methyl-5-[[(4S)-1-[(1-propan-2-ylimidazol-2-yl)methyl]azepan-4-yl]methyl]pyrazin-2-amine (PubChem CID 124944029) has the molecular formula C19H30N6 and a molecular weight of 342.49 g/mol. Its IUPAC name is N-methyl-5-[[(4S)-1-[(1-propan-2-ylimidazol-2-yl)methyl]azepan-4-yl]methyl]pyrazin-2-amine.
| Compound Name | N-methyl-5-[[(4S)-1-[(1-propan-2-ylimidazol-2-yl)methyl]azepan-4-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 124944029 |
| Molecular Formula | C19H30N6 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | N-methyl-5-[[(4S)-1-[(1-propan-2-ylimidazol-2-yl)methyl]azepan-4-yl]methyl]pyrazin-2-amine |
| SMILES | CNc1cnc(C[C@H]2CCCN(Cc3nccn3C(C)C)CC2)cn1 |
| InChI | InChI=1S/C19H30N6/c1-15(2)25-10-7-21-19(25)14-24-8-4-5-16(6-9-24)11-17-12-23-18(20-3)13-22-17/h7,10,12-13,15-16H,4-6,8-9,11,14H2,1-3H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | BGXXCFGLPBAYSS-INIZCTEOSA-N |
| XLogP | 3.14 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |