C18H20FN3O3 — CID 124944270
(3-fluoro-4-methoxyphenyl)-[(2R)-2-(2-pyrimidin-4-ylethyl)morpholin-4-yl]methanone (PubChem CID 124944270) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)-[(2R)-2-(2-pyrimidin-4-ylethyl)morpholin-4-yl]methanone.
| Compound Name | (3-fluoro-4-methoxyphenyl)-[(2R)-2-(2-pyrimidin-4-ylethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124944270 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)-[(2R)-2-(2-pyrimidin-4-ylethyl)morpholin-4-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCO[C@H](CCc3ccncn3)C2)cc1F |
| InChI | InChI=1S/C18H20FN3O3/c1-24-17-5-2-13(10-16(17)19)18(23)22-8-9-25-15(11-22)4-3-14-6-7-20-12-21-14/h2,5-7,10,12,15H,3-4,8-9,11H2,1H3/t15-/m1/s1 |
| InChIKey | BINCAODHOCNQSY-OAHLLOKOSA-N |
| XLogP | 2.10 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |