About 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone
2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone (PubChem CID 124944845) has the molecular formula C14H25F2N3O2
and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone.
Molecular Properties
| Compound Name | 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone |
| PubChem CID | 124944845 |
| Molecular Formula | C14H25F2N3O2 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone |
| SMILES | NCC(=O)N1CCC[C@](O)(CN2CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C14H25F2N3O2/c15-14(16)4-7-18(8-5-14)11-13(21)2-1-6-19(9-3-13)12(20)10-17/h21H,1-11,17H2/t13-/m1/s1 |
| InChIKey | BMTLRWHZILBYJG-CYBMUJFWSA-N |
| XLogP | 0.42 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone?
The IUPAC name of 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone (CID 124944845) is 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone.
What is the SMILES notation for 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone?
The canonical SMILES for 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone is NCC(=O)N1CCC[C@](O)(CN2CCC(F)(F)CC2)CC1.
What is the InChIKey of 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone?
The InChIKey is BMTLRWHZILBYJG-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H25F2N3O2/c15-14(16)4-7-18(8-5-14)11-13(21)2-1-6-19(9-3-13)12(20)10-17/h21H,1-11,17H2/t13-/m1/s1.
What are the key properties of 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone?
2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone has a molecular weight of 305.37 g/mol, XLogP of 0.42, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[(4R)-4-[(4,4-difluoropiperidin-1-yl)methyl]-4-hydroxyazepan-1-yl]ethanone is sourced from PubChem (CID 124944845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).