C20H26N2O3 — CID 124945572
1-[(6S)-6-[(1-acetylindol-5-yl)methyl]-1,4-oxazepan-4-yl]butan-1-one (PubChem CID 124945572) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(6S)-6-[(1-acetylindol-5-yl)methyl]-1,4-oxazepan-4-yl]butan-1-one.
| Compound Name | 1-[(6S)-6-[(1-acetylindol-5-yl)methyl]-1,4-oxazepan-4-yl]butan-1-one |
|---|---|
| PubChem CID | 124945572 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(6S)-6-[(1-acetylindol-5-yl)methyl]-1,4-oxazepan-4-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCOC[C@@H](Cc2ccc3c(ccn3C(C)=O)c2)C1 |
| InChI | InChI=1S/C20H26N2O3/c1-3-4-20(24)21-9-10-25-14-17(13-21)11-16-5-6-19-18(12-16)7-8-22(19)15(2)23/h5-8,12,17H,3-4,9-11,13-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | BRXZUUXQJDCYRW-KRWDZBQOSA-N |
| XLogP | 3.12 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |