C19H21N3O2 — CID 124945662
(E)-1-[(2S)-2-(2,6-dimethylpyrimidin-4-yl)morpholin-4-yl]-3-phenylprop-2-en-1-one (PubChem CID 124945662) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is (E)-1-[(2S)-2-(2,6-dimethylpyrimidin-4-yl)morpholin-4-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(2S)-2-(2,6-dimethylpyrimidin-4-yl)morpholin-4-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 124945662 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (E)-1-[(2S)-2-(2,6-dimethylpyrimidin-4-yl)morpholin-4-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1cc([C@@H]2CN(C(=O)/C=C/c3ccccc3)CCO2)nc(C)n1 |
| InChI | InChI=1S/C19H21N3O2/c1-14-12-17(21-15(2)20-14)18-13-22(10-11-24-18)19(23)9-8-16-6-4-3-5-7-16/h3-9,12,18H,10-11,13H2,1-2H3/b9-8+/t18-/m0/s1 |
| InChIKey | BSOHIGSIPIIBBI-BLGFXRMMSA-N |
| XLogP | 2.71 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|