C18H26N6O — CID 124948490
[(4S)-4-[(5-aminopyrazin-2-yl)methyl]azepan-1-yl]-(1-ethyl-3-methylpyrazol-4-yl)methanone (PubChem CID 124948490) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is [(4S)-4-[(5-aminopyrazin-2-yl)methyl]azepan-1-yl]-(1-ethyl-3-methylpyrazol-4-yl)methanone.
| Compound Name | [(4S)-4-[(5-aminopyrazin-2-yl)methyl]azepan-1-yl]-(1-ethyl-3-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 124948490 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(4S)-4-[(5-aminopyrazin-2-yl)methyl]azepan-1-yl]-(1-ethyl-3-methylpyrazol-4-yl)methanone |
| SMILES | CCn1cc(C(=O)N2CCC[C@H](Cc3cnc(N)cn3)CC2)c(C)n1 |
| InChI | InChI=1S/C18H26N6O/c1-3-24-12-16(13(2)22-24)18(25)23-7-4-5-14(6-8-23)9-15-10-21-17(19)11-20-15/h10-12,14H,3-9H2,1-2H3,(H2,19,21)/t14-/m0/s1 |
| InChIKey | CNJIPOFPTAKWAL-AWEZNQCLSA-N |
| XLogP | 2.07 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |