C19H18N4O — CID 124950383
pyrimidin-5-yl-[(3S)-3-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 124950383) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is pyrimidin-5-yl-[(3S)-3-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | pyrimidin-5-yl-[(3S)-3-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 124950383 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | pyrimidin-5-yl-[(3S)-3-(quinolin-4-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cncnc1)N1CC[C@H](Cc2ccnc3ccccc23)C1 |
| InChI | InChI=1S/C19H18N4O/c24-19(16-10-20-13-21-11-16)23-8-6-14(12-23)9-15-5-7-22-18-4-2-1-3-17(15)18/h1-5,7,10-11,13-14H,6,8-9,12H2/t14-/m1/s1 |
| InChIKey | DBKYALWMRHJNRT-CQSZACIVSA-N |
| XLogP | 2.73 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |