C17H20N2OS — CID 124950556
(4-methylthiophen-2-yl)-[(3S)-3-(pyridin-3-ylmethyl)piperidin-1-yl]methanone (PubChem CID 124950556) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is (4-methylthiophen-2-yl)-[(3S)-3-(pyridin-3-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | (4-methylthiophen-2-yl)-[(3S)-3-(pyridin-3-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124950556 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (4-methylthiophen-2-yl)-[(3S)-3-(pyridin-3-ylmethyl)piperidin-1-yl]methanone |
| SMILES | Cc1csc(C(=O)N2CCC[C@@H](Cc3cccnc3)C2)c1 |
| InChI | InChI=1S/C17H20N2OS/c1-13-8-16(21-12-13)17(20)19-7-3-5-15(11-19)9-14-4-2-6-18-10-14/h2,4,6,8,10,12,15H,3,5,7,9,11H2,1H3/t15-/m0/s1 |
| InChIKey | DCNPSXMTUKBQDY-HNNXBMFYSA-N |
| XLogP | 3.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |