C18H18N4O3S — CID 124952572
2-[(2R)-1-(benzenesulfonyl)piperidin-2-yl]-5-pyridin-2-yl-1,3,4-oxadiazole (PubChem CID 124952572) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-[(2R)-1-(benzenesulfonyl)piperidin-2-yl]-5-pyridin-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-[(2R)-1-(benzenesulfonyl)piperidin-2-yl]-5-pyridin-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 124952572 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[(2R)-1-(benzenesulfonyl)piperidin-2-yl]-5-pyridin-2-yl-1,3,4-oxadiazole |
| SMILES | O=S(=O)(c1ccccc1)N1CCCC[C@@H]1c1nnc(-c2ccccn2)o1 |
| InChI | InChI=1S/C18H18N4O3S/c23-26(24,14-8-2-1-3-9-14)22-13-7-5-11-16(22)18-21-20-17(25-18)15-10-4-6-12-19-15/h1-4,6,8-10,12,16H,5,7,11,13H2/t16-/m1/s1 |
| InChIKey | DPLDFGFKZNAHJV-MRXNPFEDSA-N |
| XLogP | 3.05 |
| TPSA | 89.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |