C15H18N4O2S — CID 124953555
(4-ethylthiadiazol-5-yl)-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]methanone (PubChem CID 124953555) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is (4-ethylthiadiazol-5-yl)-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]methanone.
| Compound Name | (4-ethylthiadiazol-5-yl)-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124953555 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (4-ethylthiadiazol-5-yl)-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]methanone |
| SMILES | CCc1nnsc1C(=O)N1CCO[C@H](c2ccnc(C)c2)C1 |
| InChI | InChI=1S/C15H18N4O2S/c1-3-12-14(22-18-17-12)15(20)19-6-7-21-13(9-19)11-4-5-16-10(2)8-11/h4-5,8,13H,3,6-7,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | DVXYKAIUBNCZPP-ZDUSSCGKSA-N |
| XLogP | 2.02 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |