C17H22N4O4 — CID 124953622
5,5-dimethyl-3-[2-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 124953622) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124953622 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 5,5-dimethyl-3-[2-[(2R)-2-(2-methyl-4-pyridinyl)morpholin-4-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc([C@@H]2CN(C(=O)CN3C(=O)NC(C)(C)C3=O)CCO2)ccn1 |
| InChI | InChI=1S/C17H22N4O4/c1-11-8-12(4-5-18-11)13-9-20(6-7-25-13)14(22)10-21-15(23)17(2,3)19-16(21)24/h4-5,8,13H,6-7,9-10H2,1-3H3,(H,19,24)/t13-/m0/s1 |
| InChIKey | DWKUAUJSBOFVEA-ZDUSSCGKSA-N |
| XLogP | 0.62 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|