C25H31N3O2 — CID 124953704
(3R)-1-[1-(4-methylphenyl)cyclohexanecarbonyl]-3-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 124953704) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is (3R)-1-[1-(4-methylphenyl)cyclohexanecarbonyl]-3-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[1-(4-methylphenyl)cyclohexanecarbonyl]-3-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 124953704 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | (3R)-1-[1-(4-methylphenyl)cyclohexanecarbonyl]-3-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(C2(C(=O)N3CCC[C@](C(N)=O)(c4ccccn4)C3)CCCCC2)cc1 |
| InChI | InChI=1S/C25H31N3O2/c1-19-9-11-20(12-10-19)24(13-4-2-5-14-24)23(30)28-17-7-15-25(18-28,22(26)29)21-8-3-6-16-27-21/h3,6,8-12,16H,2,4-5,7,13-15,17-18H2,1H3,(H2,26,29)/t25-/m1/s1 |
| InChIKey | DWZQAFMABLOYNJ-RUZDIDTESA-N |
| XLogP | 3.64 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |