C18H24N6O2 — CID 124954129
N-[[6-[(2R)-1-(1-propylpyrazole-3-carbonyl)pyrrolidin-2-yl]pyrazin-2-yl]methyl]acetamide (PubChem CID 124954129) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[[6-[(2R)-1-(1-propylpyrazole-3-carbonyl)pyrrolidin-2-yl]pyrazin-2-yl]methyl]acetamide.
| Compound Name | N-[[6-[(2R)-1-(1-propylpyrazole-3-carbonyl)pyrrolidin-2-yl]pyrazin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 124954129 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[[6-[(2R)-1-(1-propylpyrazole-3-carbonyl)pyrrolidin-2-yl]pyrazin-2-yl]methyl]acetamide |
| SMILES | CCCn1ccc(C(=O)N2CCC[C@@H]2c2cncc(CNC(C)=O)n2)n1 |
| InChI | InChI=1S/C18H24N6O2/c1-3-7-23-9-6-15(22-23)18(26)24-8-4-5-17(24)16-12-19-10-14(21-16)11-20-13(2)25/h6,9-10,12,17H,3-5,7-8,11H2,1-2H3,(H,20,25)/t17-/m1/s1 |
| InChIKey | FAFLGBYETCRTPA-QGZVFWFLSA-N |
| XLogP | 1.70 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |