C17H20FN3O — CID 124958305
2-[(3R)-1-[2-(4-fluorophenoxy)ethyl]pyrrolidin-3-yl]-4-methylpyrimidine (PubChem CID 124958305) has the molecular formula C17H20FN3O and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[(3R)-1-[2-(4-fluorophenoxy)ethyl]pyrrolidin-3-yl]-4-methylpyrimidine.
| Compound Name | 2-[(3R)-1-[2-(4-fluorophenoxy)ethyl]pyrrolidin-3-yl]-4-methylpyrimidine |
|---|---|
| PubChem CID | 124958305 |
| Molecular Formula | C17H20FN3O |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 2-[(3R)-1-[2-(4-fluorophenoxy)ethyl]pyrrolidin-3-yl]-4-methylpyrimidine |
| SMILES | Cc1ccnc([C@@H]2CCN(CCOc3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C17H20FN3O/c1-13-6-8-19-17(20-13)14-7-9-21(12-14)10-11-22-16-4-2-15(18)3-5-16/h2-6,8,14H,7,9-12H2,1H3/t14-/m1/s1 |
| InChIKey | GFEQCIXGMHBSQQ-CQSZACIVSA-N |
| XLogP | 2.79 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |