About 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one
5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 124958911) has the molecular formula C17H24N4O3
and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 124958911 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | O=c1cc([C@@H]2CCCCN2CC2(O)CCOCC2)nc2cc[nH]n12 |
| InChI | InChI=1S/C17H24N4O3/c22-16-11-13(19-15-4-7-18-21(15)16)14-3-1-2-8-20(14)12-17(23)5-9-24-10-6-17/h4,7,11,14,18,23H,1-3,5-6,8-10,12H2/t14-/m0/s1 |
| InChIKey | GEUNOSBGIROYSO-AWEZNQCLSA-N |
| XLogP | 1.09 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 124958911) is 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is O=c1cc([C@@H]2CCCCN2CC2(O)CCOCC2)nc2cc[nH]n12.
What is the InChIKey of 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is GEUNOSBGIROYSO-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H24N4O3/c22-16-11-13(19-15-4-7-18-21(15)16)14-3-1-2-8-20(14)12-17(23)5-9-24-10-6-17/h4,7,11,14,18,23H,1-3,5-6,8-10,12H2/t14-/m0/s1.
What are the key properties of 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one?
5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 332.40 g/mol, XLogP of 1.09, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S)-1-[(4-hydroxyoxan-4-yl)methyl]piperidin-2-yl]-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 124958911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).