About 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole
2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole (PubChem CID 124959224) has the molecular formula C16H19ClFN3
and a molecular weight of 307.80 g/mol. Its IUPAC name is 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole.
Molecular Properties
| Compound Name | 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole |
| PubChem CID | 124959224 |
| Molecular Formula | C16H19ClFN3 |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole |
| SMILES | Cc1cn(C)c([C@H]2CCN(Cc3ccc(Cl)cc3F)C2)n1 |
| InChI | InChI=1S/C16H19ClFN3/c1-11-8-20(2)16(19-11)13-5-6-21(10-13)9-12-3-4-14(17)7-15(12)18/h3-4,7-8,13H,5-6,9-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | GLVWGNHKYJGHKU-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole?
The IUPAC name of 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole (CID 124959224) is 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole.
What is the SMILES notation for 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole?
The canonical SMILES for 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole is Cc1cn(C)c([C@H]2CCN(Cc3ccc(Cl)cc3F)C2)n1.
What is the InChIKey of 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole?
The InChIKey is GLVWGNHKYJGHKU-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H19ClFN3/c1-11-8-20(2)16(19-11)13-5-6-21(10-13)9-12-3-4-14(17)7-15(12)18/h3-4,7-8,13H,5-6,9-10H2,1-2H3/t13-/m0/s1.
What are the key properties of 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole?
2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole has a molecular weight of 307.80 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-1-[(4-chloro-2-fluorophenyl)methyl]pyrrolidin-3-yl]-1,4-dimethylimidazole is sourced from PubChem (CID 124959224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).