About 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone
2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone (PubChem CID 124959831) has the molecular formula C29H28N2O3
and a molecular weight of 452.55 g/mol. Its IUPAC name is 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone.
Molecular Properties
| Compound Name | 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone |
| PubChem CID | 124959831 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone |
| SMILES | O=C(N1CCOC[C@H](Cc2cncc3ccccc23)C1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28N2O3/c32-28(29(33,25-10-3-1-4-11-25)26-12-5-2-6-13-26)31-15-16-34-21-22(20-31)17-24-19-30-18-23-9-7-8-14-27(23)24/h1-14,18-19,22,33H,15-17,20-21H2/t22-/m1/s1 |
| InChIKey | GQBBGIDVSAORGM-JOCHJYFZSA-N |
| XLogP | 4.19 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone?
The IUPAC name of 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone (CID 124959831) is 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone.
What is the SMILES notation for 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone?
The canonical SMILES for 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone is O=C(N1CCOC[C@H](Cc2cncc3ccccc23)C1)C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone?
The InChIKey is GQBBGIDVSAORGM-JOCHJYFZSA-N. The full InChI is InChI=1S/C29H28N2O3/c32-28(29(33,25-10-3-1-4-11-25)26-12-5-2-6-13-26)31-15-16-34-21-22(20-31)17-24-19-30-18-23-9-7-8-14-27(23)24/h1-14,18-19,22,33H,15-17,20-21H2/t22-/m1/s1.
What are the key properties of 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone?
2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone has a molecular weight of 452.55 g/mol, XLogP of 4.19, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-[(6R)-6-(isoquinolin-4-ylmethyl)-1,4-oxazepan-4-yl]-2,2-diphenylethanone is sourced from PubChem (CID 124959831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).