C21H22N4O — CID 124961648
(2-methylpyrimidin-5-yl)-[(3R)-3-(quinolin-3-ylmethyl)piperidin-1-yl]methanone (PubChem CID 124961648) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is (2-methylpyrimidin-5-yl)-[(3R)-3-(quinolin-3-ylmethyl)piperidin-1-yl]methanone.
| Compound Name | (2-methylpyrimidin-5-yl)-[(3R)-3-(quinolin-3-ylmethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124961648 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (2-methylpyrimidin-5-yl)-[(3R)-3-(quinolin-3-ylmethyl)piperidin-1-yl]methanone |
| SMILES | Cc1ncc(C(=O)N2CCC[C@H](Cc3cnc4ccccc4c3)C2)cn1 |
| InChI | InChI=1S/C21H22N4O/c1-15-22-12-19(13-23-15)21(26)25-8-4-5-16(14-25)9-17-10-18-6-2-3-7-20(18)24-11-17/h2-3,6-7,10-13,16H,4-5,8-9,14H2,1H3/t16-/m1/s1 |
| InChIKey | HDAWCWXSNDHQTC-MRXNPFEDSA-N |
| XLogP | 3.43 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |