C17H18FN3O3 — CID 124963745
(5-fluoro-2-methoxyphenyl)-[(2S)-2-(4-methylpyrimidin-2-yl)morpholin-4-yl]methanone (PubChem CID 124963745) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)-[(2S)-2-(4-methylpyrimidin-2-yl)morpholin-4-yl]methanone.
| Compound Name | (5-fluoro-2-methoxyphenyl)-[(2S)-2-(4-methylpyrimidin-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124963745 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)-[(2S)-2-(4-methylpyrimidin-2-yl)morpholin-4-yl]methanone |
| SMILES | COc1ccc(F)cc1C(=O)N1CCO[C@H](c2nccc(C)n2)C1 |
| InChI | InChI=1S/C17H18FN3O3/c1-11-5-6-19-16(20-11)15-10-21(7-8-24-15)17(22)13-9-12(18)3-4-14(13)23-2/h3-6,9,15H,7-8,10H2,1-2H3/t15-/m0/s1 |
| InChIKey | HSMXWBIMSSYZSX-HNNXBMFYSA-N |
| XLogP | 2.15 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |