C18H24N4O3 — CID 124964953
5,5-dimethyl-3-[2-[(3R)-4-methyl-3-phenylpiperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 124964953) has the molecular formula C18H24N4O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[(3R)-4-methyl-3-phenylpiperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[(3R)-4-methyl-3-phenylpiperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124964953 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 5,5-dimethyl-3-[2-[(3R)-4-methyl-3-phenylpiperazin-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CN1CCN(C(=O)CN2C(=O)NC(C)(C)C2=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H24N4O3/c1-18(2)16(24)22(17(25)19-18)12-15(23)21-10-9-20(3)14(11-21)13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3,(H,19,25)/t14-/m0/s1 |
| InChIKey | IBJJLLCYYKPXQK-AWEZNQCLSA-N |
| XLogP | 0.83 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|