About 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one
1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one (PubChem CID 124967381) has the molecular formula C18H23N3O
and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one |
| PubChem CID | 124967381 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC[C@@H](Cc2ccnc3ccncc23)CC1 |
| InChI | InChI=1S/C18H23N3O/c1-2-18(22)21-10-3-4-14(7-11-21)12-15-5-9-20-17-6-8-19-13-16(15)17/h5-6,8-9,13-14H,2-4,7,10-12H2,1H3/t14-/m1/s1 |
| InChIKey | ISLPMVFJECNXFD-CQSZACIVSA-N |
| XLogP | 3.21 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one?
The IUPAC name of 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one (CID 124967381) is 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one.
What is the SMILES notation for 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one?
The canonical SMILES for 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one is CCC(=O)N1CCC[C@@H](Cc2ccnc3ccncc23)CC1.
What is the InChIKey of 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one?
The InChIKey is ISLPMVFJECNXFD-CQSZACIVSA-N. The full InChI is InChI=1S/C18H23N3O/c1-2-18(22)21-10-3-4-14(7-11-21)12-15-5-9-20-17-6-8-19-13-16(15)17/h5-6,8-9,13-14H,2-4,7,10-12H2,1H3/t14-/m1/s1.
What are the key properties of 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one?
1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one has a molecular weight of 297.40 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-4-(1,6-naphthyridin-4-ylmethyl)azepan-1-yl]propan-1-one is sourced from PubChem (CID 124967381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).