C20H25N3O2 — CID 124969498
2-(2-methylphenyl)-1-[(2S)-2-[2-(6-methylpyrimidin-4-yl)ethyl]morpholin-4-yl]ethanone (PubChem CID 124969498) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1-[(2S)-2-[2-(6-methylpyrimidin-4-yl)ethyl]morpholin-4-yl]ethanone.
| Compound Name | 2-(2-methylphenyl)-1-[(2S)-2-[2-(6-methylpyrimidin-4-yl)ethyl]morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 124969498 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-(2-methylphenyl)-1-[(2S)-2-[2-(6-methylpyrimidin-4-yl)ethyl]morpholin-4-yl]ethanone |
| SMILES | Cc1cc(CC[C@H]2CN(C(=O)Cc3ccccc3C)CCO2)ncn1 |
| InChI | InChI=1S/C20H25N3O2/c1-15-5-3-4-6-17(15)12-20(24)23-9-10-25-19(13-23)8-7-18-11-16(2)21-14-22-18/h3-6,11,14,19H,7-10,12-13H2,1-2H3/t19-/m0/s1 |
| InChIKey | JJIVHRBVCGNHCN-IBGZPJMESA-N |
| XLogP | 2.50 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |