C18H13N3O2S2 — CID 1249697
N-(2-methylsulfanylphenyl)-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide (PubChem CID 1249697) has the molecular formula C18H13N3O2S2 and a molecular weight of 367.46 g/mol. Its IUPAC name is N-(2-methylsulfanylphenyl)-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide.
| Compound Name | N-(2-methylsulfanylphenyl)-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
|---|---|
| PubChem CID | 1249697 |
| Molecular Formula | C18H13N3O2S2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | N-(2-methylsulfanylphenyl)-2-oxo-6-thia-1,8-diazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carboxamide |
| SMILES | CSc1ccccc1NC(=O)c1cc2c(=O)n3ccccc3nc2s1 |
| InChI | InChI=1S/C18H13N3O2S2/c1-24-13-7-3-2-6-12(13)19-16(22)14-10-11-17(25-14)20-15-8-4-5-9-21(15)18(11)23/h2-10H,1H3,(H,19,22) |
| InChIKey | YTXHDQHTRLAAON-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |