About phenyl propanoate
phenyl propanoate (PubChem CID 12497) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is phenyl propanoate.
Molecular Properties
| Compound Name | phenyl propanoate |
| PubChem CID | 12497 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | phenyl propanoate |
| SMILES | CCC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C9H10O2/c1-2-9(10)11-8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | DYUMLJSJISTVPV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl propanoate?
The IUPAC name of phenyl propanoate (CID 12497) is phenyl propanoate.
What is the SMILES notation for phenyl propanoate?
The canonical SMILES for phenyl propanoate is CCC(=O)Oc1ccccc1.
What is the InChIKey of phenyl propanoate?
The InChIKey is DYUMLJSJISTVPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-2-9(10)11-8-6-4-3-5-7-8/h3-7H,2H2,1H3.
What are the key properties of phenyl propanoate?
phenyl propanoate has a molecular weight of 150.18 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl propanoate is sourced from PubChem (CID 12497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).